You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on ClassyFire.

Export to:

JSON
Select 'All' to list all the chemical categories. Each character links to a view of all chemical categories whose name begin by it. The asterisk (*) links to a view of all categories whose name start with a special character (e.g. '('). You can search the table for a specific string within that specific view.
NameChemOnt IDDescription
O-acylglycerone-phosphatesCHEMONTID:0003448Glycerone-3-phosphates carrying an acyl substituent at the 1-position.
O-alkylglycerone phosphatesCHEMONTID:0003447Glycerone-3-phosphates carrying an alkyl substituent at the 1-position.
O-alkylglyceronesCHEMONTID:0003445Organic compounds containing a glycerone that carries an acyl substituent at the 1-position or the 2-position.
O-alkylpyrimidinesCHEMONTID:0004486Compounds containing a pyrimidine , which is O-alkylated at one or more ring positions.
o-AminophenolsCHEMONTID:0004654Phenols that are substituted with an amine group at the 2-position of the benzene ring.
O-benzoquinonesCHEMONTID:0002492Benzoquinones where the two C=O groups are attached at the 1- and 2-positions, respectively.
O-bromophenolsCHEMONTID:0002768Bromophenols carrying a iodine at the C2 position of the benzene ring.
O-chlorophenolsCHEMONTID:0002771Chlorophenols carrying a iodine at the C2 position of the benzene ring.
O-cinnamoyl glycosidesCHEMONTID:0003479O-glycoside derivatives of cinnamic acid. Cinnamic acid is an aromatic compound containing a benzene and a carboxylic acid group forming 3-phenylprop-2-enoic acid.
O-coumaroyl glycosidesCHEMONTID:0002684Glycosides of o-coumaric acids. O-coumaric acids are aromatic compounds containing a cinnamic acid moiety hydroxylated at the C2 carbon atom of the benzene ring.
O-fluorophenolsCHEMONTID:0002774Fluorophenols carrying a iodine at the C2 position of the benzene ring.
O-galloylquinic acids and derivativesCHEMONTID:0002513Compounds containing a galloic acid moiety, linked to one hydroxyl group of a quinic acid moiety.
O-glucuronidesCHEMONTID:0002813Glucuronides in which the aglycone is linked to the carbohydrate unit through an O-glycosidic bond.
O-glycosyl compoundsCHEMONTID:0002207Glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond.
O-haloacetanilidesCHEMONTID:0004718Organic compounds containing an acetamide group conjugated to a phenyl group, which is in turn ortho-substituted with a halogen atom.
o-Hydroxybenzoic acid estersCHEMONTID:0004700Benzoic acid esters where the benzene ring is ortho-substituted with a hydroxy group.
O-iminoquinonesCHEMONTID:0002388O-quinones that carry an imine group.
O-iodophenolsCHEMONTID:0002777Iodophenols carrying a iodine at the C2 position of the benzene ring.
O-methoxybenzoic acids and derivativesCHEMONTID:0002345Benzoic acids in which the hydrogen atom at position 2 of the benzene ring is replaced by a methoxy group.
O-methylated flavonoidsCHEMONTID:0002585Flavonoids with methoxy groups conjugated to the flavonoid backbone.
O-methylated isoflavonoidsCHEMONTID:0002586Isoflavonoids with methoxy groups conjugated to the isoflavonoid backbone. Isoflavonoids are natural products derived from 3-phenylchromen-4-one.
O-phenylenediaminesCHEMONTID:0004746Aromatic compound containing a benzene ring which carries 2 amino groups, at the 1- and 2-positions.
O-phenylhydroxylaminesCHEMONTID:0004651Hydroxylamines that are O-substituted with a phenyl group.
o-Phthalate estersCHEMONTID:0004011Ester derivatives of o-phthalic acids, which are based on a benzene 1,2-dicarboxylic acid skeleton.
O-phthalic acid and derivativesCHEMONTID:0001107Compounds containing a benzene ring bearing a carboxylic acid group at ring carbon atoms 1 and 3.
O-quinodimethanesCHEMONTID:0001778Compounds containing a benzene ring conjugated to two methylidene groups at carbon atoms 1 and 2, respectively.
O-quinomethanesCHEMONTID:0002122Organic compounds containing a benzene ring conjugated to a methylidene group and a ketone at carbon atoms 1 and 2, respectively.
O-quinonesCHEMONTID:0002385Quinones where the two C=O groups are attached at the 1- and 2-positions, respectively.
O-quinoniminesCHEMONTID:0002894Quinonimines in which the imine groups are in a ortho-relationship.
O-sulfanylbenzoic acidsCHEMONTID:0003106Benzoic acids which bear a sulfanyl group (R-SH) attached to the benzene ring at positions 1 and 2, respectively.
O-sulfanylbenzoic acids and derivativesCHEMONTID:0003105Benzoic acids (or derivatives) which bear a sulfanyl group (R-SH) attached to the benzene ring at positions 1 and 2, respectively.
O-terphenylsCHEMONTID:0001836Terphenyls with a structure containing the 1,2-diphenylbenzene skeleton.
O-thiocarbamatesCHEMONTID:0004425O-ester derivatives of thiocarbamic acid, with the general formula ROC(=S)NR2.
o-ToluamidesCHEMONTID:0004221Aromatic compounds containing a toluene, which carries a carboxamide group a the 2-position.
o-XylenesCHEMONTID:0004210Aromatic compounds that contain a o-xylene moiety, which is a monocyclic benzene carrying exactly two methyl groups at the 1- and 2-positions.
o-XylenolsCHEMONTID:0004214Aromatic compounds that contain a o-xylenol moiety, which is a monocyclic benzene carrying exactly two methyl groups at the 1- and 2-positions, and at least one hydroxyl group.
Ochratoxins and related substancesCHEMONTID:0001787A group of chemically related metabolites containing a 3,4-dihydro-3-methylisocoumarin moiety linked through a carboxyl group to L-beta-phenylalanine by a secondary amine bond.
OctosesCHEMONTID:0001500Monosaccharide compounds in which the sugar moiety is an octose (8 carbon atoms).
Okadaic acids and derivativesCHEMONTID:0001802Marine heterocyclic polyethers containing the okadaic acid skeleton.
Oleanane triterpenoidsCHEMONTID:0000180Triterpenoids with a structure based on the oleanane skeleton, an 4,4,6a,8a,11,14b-heptamethyl-hexadecahydropicene derivative.
OlefinsCHEMONTID:0002838Acyclic and cyclic hydrocarbons having one or more carbon-carbon double bonds, apart from the formal ones in aromatic compounds. The class of olefins subsumes alkenes and cycloalkenes and the corresponding polyenes.
OligoanthrilamidesCHEMONTID:0001956Compounds containing several anthranilamide (2-aminobenzamide) moieties, where the amine group of one moiety is bound to the amide group of another moiety.
OligocarbamatesCHEMONTID:0001955Compounds containing several carbamate groups linked to each other.
OligonucleotidesCHEMONTID:0004351Organic polymers made up of a sequence of 3 to 12 purine or pyrimidine nucleotide residues linked to one another from the 5' -end to the 3'-end through a phosphate group.
OligopeptidesCHEMONTID:0004831Organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds.
OligophosphenesCHEMONTID:0002488Organophosphorus compounds with the general formula RP=P-PR' (R=alkyl, aryl).
Oligosaccharide phosphatesCHEMONTID:0002191Carbohydrates containing between 3 and 9 sugar units, one of which bear one or more phosphate groups.
Oligosaccharide sulfatesCHEMONTID:0003308Carbohydrates containing between 3 and 9 sugar units, one of which bear one or more sulfate groups.
OligosaccharidesCHEMONTID:0000198Carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds.
OligosulfonesCHEMONTID:0001954Compounds containing several sulfone groups linked to each other.
OligosulfoxidesCHEMONTID:0001953Compounds containing several sulfoxide groups linked to each other. They have the general formula R1(S(O)C(R2)C)nC (R1 = organyl; R2=any group).
OligothioureasCHEMONTID:0001944Compounds containing several thiourea groups linked to each other.
Oligourea amidesCHEMONTID:0001952Compounds containing several urea-amide units (RNC(=O)CNC(=O)N(R')CN), which consists of alternating amide and urea functional groups.
OligoureasCHEMONTID:0001951Compounds containing several urea groups linked to each other. Urea is an organic compound with the formula CO(NH2)2.
Ophiobolane sesterterpenoidsCHEMONTID:0002882Sesterterpnoids with a structure based on the ophiobolane backbone. Ophiobolane is a tricyclic compound consisting of two cyclopentane rings joined by a cyclooctane ring, and carries a methyl group at the 1-, 4-, and 8-position, as well as a 6-methylheptane group at the 12-position.
Organic 1,3-dipolar compoundsCHEMONTID:0003630Electrically neutral organic molecules carrying a positive and a negative charge in one of their major canonical descriptions. In most dipolar compounds the charges are delocalized; however the term is also applied to species where this is not the case. The term 1,3-dipolar compounds is used for those in which a significant canonical resonance form can be represented by a separation of charge over three atoms (in connection with 1,3-dipolar cycloadditions).
Organic acids and derivativesCHEMONTID:0000264Compounds an organic acid or a derivative thereof.
Organic alkali metal saltsCHEMONTID:0004099Organic salts of an alkali metal. The alkali metal atom is usually in its ionic form.
Organic aluminatesCHEMONTID:0001839Organic compounds containing an aluminate oxoanion, with the formula [AlO2]-.
Organic aluminium saltsCHEMONTID:0004041Organic salt compounds containing a tin atom in its ionic form.
Organic anionsCHEMONTID:0003608Organic compounds that have a negative electric charge.
Organic antimonatesCHEMONTID:0001740Organic compounds containing the antimonate oxoanion, with the formula Sb(OH)6-.
Organic antimony saltsCHEMONTID:0004078Organic salts of antimony. They usually contain antimony in its ionic form.
Organic arsenatesCHEMONTID:0001806Organic compounds containing the arsenate oxoanion, with the formula AsO43-.
Organic azidesCHEMONTID:0000126Compounds bearing the group N3, viz. -N=N+=N-; usually attached to carbon, e.g. PhN3 phenyl azide or azidobenzene.
Organic beryllium saltsCHEMONTID:0004489Organic compounds containing a beryllium ion.
Organic bromate saltsCHEMONTID:0004458Organic salts of bromate. They contain bromate in its ionic form or conjugated to a metal atom.
Organic bromatesCHEMONTID:0001259Organic compounds containing the bromate oxoanion, with the formula BrO3-.
Organic bromide saltsCHEMONTID:0003930Organic compounds containing a bromine ion.
Organic cadmium saltsCHEMONTID:0004075Organic salts of cadmium. They usually contain cadmium in its ionic form.
Organic calcium saltsCHEMONTID:0004493Organic salts containing a calcium ion.
Organic carbonic acidsCHEMONTID:0001521Compounds comprising the carbonic acid functional group.
Organic carbonic acids and derivativesCHEMONTID:0000364Compounds comprising the organic carbonic acid or a derivative thereof.
Organic cationsCHEMONTID:0003609Organic compounds with a positive electric charge.
Organic chloratesCHEMONTID:0001260Organic compounds containing the chlorate oxoanion, with the formula ClO3-.
Organic chloride saltsCHEMONTID:0003931Organic compounds containing a chlorine ion.
Organic chlorite saltsCHEMONTID:0004462Organic salts containing the chlorite group, in its ionic form or bound to a metal atom.
Organic chloritesCHEMONTID:0001261Organic compounds containing the chlorite oxoanion, with the formula ClO2-.
Organic chromatesCHEMONTID:0001278Organic compounds containing the chromate oxoanion, with the formula [CrO4]2-.
Organic chromitesCHEMONTID:0001307Organic compounds containing the chromate oxoanion, with the formula Cr(O2)−.
Organic chromium saltsCHEMONTID:0004369Organic salt compounds containing a chromium atom in its ionic form.
Organic chromium trioxidesCHEMONTID:0004820Organic compounds containing a chromium trioxide moiety.
Organic cobalt saltsCHEMONTID:0003995Organic salt compounds containing a cobalt atom in its ionic form.
Organic compoundsCHEMONTID:0000000Compounds that contain at least one carbon atom, excluding isocyanide/cyanide and their non-hydrocarbyl derivatives, thiophosgene, carbon diselenide, carbon monosulfide, carbon disulfide, carbon subsulfide, carbon monoxide, carbon dioxide, Carbon suboxide, and dicarbon monoxide.
Organic copper saltsCHEMONTID:0004018Organic salt compounds containing a copper atom in its ionic form.
Organic cyanamidesCHEMONTID:0000361Organic compounds comprising the cyanamide functional group, with the general structure R1N=C=NR2.
Organic cyanidesCHEMONTID:0004504Organic nitrogen compounds that contain the cyano (C#N) group. The group can be present either in the anionic or covalently bond form.
Organic diazonium saltsCHEMONTID:0001668Organic compounds comprising the diazonium functional group, with the general structure R-N=N+.
Organic dichromatesCHEMONTID:0004803Organic compounds containing a dichromate moiety.
Organic disulfidesCHEMONTID:0002800Organosulfur compounds with the general formula RSSR' (R,R' = alkyl, aryl).
Organic dithionitesCHEMONTID:0002081Organic compounds containing the dithionite oxoanion, with the formula [S2O4]2−.
Organic dithiophosphoric acids and derivativesCHEMONTID:0003385Organic compounds that contain dithiophosphoric acid or a derivative thereof, with the general formula ROP(S)(=S)OR', (R,R'=H, or organyl group).
Organic fluorophosphonic acids and derivativesCHEMONTID:0001247Organic compounds containing fluorophosphonic acid or a derivative thereof.
Organic hydroperoxidesCHEMONTID:0001308Organic compounds comprising the hydroperoxide functional group, with the general formula [O-O]2-.
Organic hydroxidesCHEMONTID:0001364Organic compounds comprising the hydroxide functional group, with the general formula OH-.
Organic hypobromitesCHEMONTID:0001444Organic compounds containing the hypobromite oxoanion, with the formula BrO-.
Organic hypochloritesCHEMONTID:0001526Organic compounds containing the hypochlorite oxoanion, with the formula ClO-.
Organic hyponitritesCHEMONTID:0001577Organic compounds containing the hyponitrite oxoanion, with the formula ([ON=NO]2-.
Organic hypophosphitesCHEMONTID:0001589Organic compounds containing the hypophosphite oxoanion, with the formula PO2−.
Organic hyposulfitesCHEMONTID:0002082Organic compounds containing the hyposulfite oxoanion, with the formula [SO2]2-.
Organic iodate saltsCHEMONTID:0004460Organic salts containing the iodate group, in its ionic form or bound to a metal atom.
Organic iodatesCHEMONTID:0001590Organic compounds containing the iodate oxoanion, with the formula IO3-.
Organic iodide saltsCHEMONTID:0003932Organic compounds containing a iodine ion.
Organic isocyanidesCHEMONTID:0001306Organic compounds containing the isomer HN+#C- of hydrocyanic acid, HC#N, or its hydrocarbyl derivatives RNC (RN+#C-).
Organic lead saltsCHEMONTID:0004051Organic salts containing a lead ion.
Organic lithium saltsCHEMONTID:0004488Organic compounds containing a lithium ion.
Organic metal bromide saltsCHEMONTID:0004037Organic metal salts containing a bromine atom in its ionic form.
Organic metal halidesCHEMONTID:0004491Organic compounds containing metals and halogens. Some are ionic while others are covalently bonded.
Organic metal saltsCHEMONTID:0004036Organic salt compounds containing a metal atom in its ionic form.
Organic metalloid saltsCHEMONTID:0003998Organic salt compounds containing a metalloid atom in its ionic form.
Organic metavanadatesCHEMONTID:0003294Organic compounds containing the metavanadate oxoanion, with the formula [VO4]3-.
Organic N-nitroso compoundsCHEMONTID:0004777Organic compounds containing a n-nitroso group -NN=O.
Organic nitratesCHEMONTID:0000395Organic compounds containing the nitrate oxoanion, with the formula NO3-.
Organic nitrenesCHEMONTID:0003973Compounds containing a bond between a carbon and a nitrogen atom with only 2 pairs of unshared electrons.
Organic nitric acidsCHEMONTID:0002487Compounds containing an organonitric acid group.
Organic nitric acids and derivativesCHEMONTID:0000488Compounds containing an organonitric acid group or a derivative thereof.
Organic nitritesCHEMONTID:0000396Organic compounds containing the nitrite oxoanion, with the formula NO2-.
Organic nitro compoundsCHEMONTID:0001152Compounds having the nitro group, -NO2 (free valence on nitrogen), which may be attached to carbon, nitrogen (as in nitramines), or oxygen (as in nitrates), among other elements (in the absence of specification, C-nitro compounds are usually implied).
Organic nitrogen compoundsCHEMONTID:0004707Organic compounds containing a nitrogen atom.
Organic nitrosaminesCHEMONTID:0001400Organic compounds containing the nitrosamine functional group, with the structure R2NN=O.
Organic nitroso compoundsCHEMONTID:0004776Organic compounds having the nitroso group, -NO, attached to carbon, or to another element, most commonly nitrogen or oxygen.
Organic nitrosonium compoundsCHEMONTID:0001520Organic compounds containing the nitrosonium cation, with the general formula NO+.
Organic O-nitroso compoundsCHEMONTID:0004778Organic compounds containing a n-nitroso group -ON=O.
Organic orthonitratesCHEMONTID:0002065Organic compounds containing the orhthonitrate oxoanion, with the formula [NO4]3−.
Organic orthovanadatesCHEMONTID:0001841Organic compounds containing the orthovanadate oxoanion, with the formula [VO4]3-.
Organic oxidesCHEMONTID:0003940Organic compounds containing an oxide group.
Organic oxoanionic compoundsCHEMONTID:0000463Organic compounds containing an oxoanion.
Organic oxoazanium compoundsCHEMONTID:0001508Organic compounds comprising the oxoazanium cation, with the formula N+=O.
Organic oxygen compoundsCHEMONTID:0004603Organic compounds that contain one or more oxygen atoms.
Organic perbromatesCHEMONTID:0002066Organic compounds containing the perbromate oxoanion, with the formula [BrO4]-.
Organic perchlorate saltsCHEMONTID:0003933Organic compounds containing a perchlorate ion.
Organic perchloratesCHEMONTID:0002067Organic compounds containing the perchlorate oxoanion, with the formula [ClO4]-.
Organic periodatesCHEMONTID:0002068Organic compounds containing the periodate oxoanion, with the formula [IO4]-.
Organic permanganatesCHEMONTID:0002069Organic compounds containing the permanganate oxoanion, with the formula [MnO4]-.
Organic peroxidesCHEMONTID:0000414Organic compounds containing the peroxide group, with the formula R1OOR2 (R1,R2=H, alkyl, aryl).
Organic peroxodisulfatesCHEMONTID:0002077Organic compounds containing the peroxodisulfate oxoanion, with the formula [S2O8]2−.
Organic peroxomonosulfatesCHEMONTID:0002076Organic compounds containing the peroxomonosulfate oxoanion, with the formula [SO5]2-.
Organic peroxynitratesCHEMONTID:0001837Organic compounds containing the peroxynitrate oxoanion, with the formula [NO4]−.
Organic peroxynitritesCHEMONTID:0001838Organic compounds containing the peroxonitrite oxoanion, with the formula ONOO-.
Organic perrhenatesCHEMONTID:0001222Organic compounds containing the perrhenate oxoanion, with the formula [ReO4]-.
Organic pertechnetatesCHEMONTID:0002070Organic compounds containing the pertechnetate oxoanion, with the formula [TcO4]-.
Organic phosphines and derivativesCHEMONTID:0000401Organic compounds containing a phosphine derivative, with the general formula B1P(R2)R3 (R1-R3=alkyl, aryl).
Organic phosphite saltsCHEMONTID:0004463Organic salts containing a phosphite group, in its ionic form or bound to a metal atom.
Organic phosphitesCHEMONTID:0002071Organic compounds containing the phosphite oxoanion, with the formula [PO3]3-.
Organic phosphonic acid diamidesCHEMONTID:0003892Organophosphorus compounds containing a diamide derivative of phosphonic acid, with the general structure R1P(=O)(N(R2)R3)N(R4)R5, where R = organyl and R2-R5 = H or organyl group.
Organic phosphonic acidsCHEMONTID:0001302Organic compounds containing phosphonic acid.
Organic phosphonic acids and derivativesCHEMONTID:0000419Organic compounds containing phosphonic acid or a derivative thereof.
Organic phosphoramidesCHEMONTID:0001204Organic compounds containing the phosphoric acid amide functional group.
Organic phosphoric acid diamidesCHEMONTID:0003662Organophosphorus compounds with the general formula RNP(R2)(O)=O (R=alkyl, aryl; R2 = amine group).
Organic phosphoric acid halidesCHEMONTID:0001206Organic compounds containing the phosphoric acid halide functional group with the general structure OP(O)(=O)OX (X = halogen atom).
Organic phosphoric acid monoamidesCHEMONTID:0002857Organophosphorus compounds with the general formula RNP(O)(O)=O (R=alkyl, aryl).
Organic phosphoric acid triamidesCHEMONTID:0003871Organophosphorus compounds with the general formula RNP(R2)(R3)=O (R=alkyl, aryl; R2-R3 = amine groups).
Organic phosphoric acidsCHEMONTID:0001574Organic compounds containing phosphoric acid, with the general structure OP(O)(=O)O.
Organic phosphoric acids and derivativesCHEMONTID:0000402Organic compounds containing phosphoric acid or a derivative thereof.
Organic plumbatesCHEMONTID:0001153Organic compounds containing a plumbate oxoanion, with the formula [PbO3]2-.
Organic PolymersCHEMONTID:0003297Organic compounds, generally large molecules or macromolecules, which are composed of many repeating units.
Organic post-transition metal saltsCHEMONTID:0004040Organic salt compounds containing a post-transition metal atom in its ionic form.
Organic potassium saltsCHEMONTID:0003927Organic compounds containing a potassium ion.
Organic pyrophosphatesCHEMONTID:0001804Organic compounds containing the pyrophosphate oxoanion, with the structure OP([O-])(=O)OP(O)([O-])=O.
Organic pyrosulfatesCHEMONTID:0002078Organic compounds containing the pyrosulfate oxoanion, with the structure OS([O-])(=O)OS(O)([O-])=O.
Organic S-nitroso compoundsCHEMONTID:0004779Organic compounds containing a n-nitroso group -SN=O.
Organic saltsCHEMONTID:0003865Organic compounds consisting of an assembly of cations and anions.
Organic selenatesCHEMONTID:0002072Organic compounds containing the selenate oxoanion, with the formula [SeO4]2-.
Organic selenite saltsCHEMONTID:0004459Organic salts containing a selenite group, in its ionic form or bound to a metal atom.
Organic selenitesCHEMONTID:0002073Organic compounds containing the selenite oxoanion, with the formula [SeO3]2-.
Organic silver saltsCHEMONTID:0004063Organic salt compounds containing a copper atom either in its ionic form or bonded to another atom.
Organic sodium saltsCHEMONTID:0003928Organic compounds containing a sodium ion.
Organic stannatesCHEMONTID:0001840Organic compounds containing a stannate oxoanion, with the formula [SnO3]2-.
Organic sulfate saltsCHEMONTID:0003929Organic compounds containing a sulfate ion.
Organic sulfite saltsCHEMONTID:0004455Organic salts of the sulfite ion.
Organic sulfitesCHEMONTID:0004456Organic compounds containing the selenite oxoanion, with the formula [SO3]2-, or its conjugated base.
Organic sulfonamidesCHEMONTID:0004439Organic compounds containing the sulfonamide functional group, an amide of sulfonic acid with the general structure R1S(=O)2N(R2)R3 (R1=H or organyl; R2,R3=H, alkyl, aryl).
Organic sulfonic acidsCHEMONTID:0004438Organic compounds containing a sulfonic acid or derivative, with the general structure RS(=O)2OH (R= H or organyl group).
Organic sulfonic acids and derivativesCHEMONTID:0004434Compounds containing a sulfonic acid or derivative, with the general structure RS(=O)2X (R= H or organyl group, X=any heteroatom).
Organic sulfonic anhydridesCHEMONTID:0004437Organic compounds having the structure RS(=O)2OS(=O)2R', where R , R' = H or organyl group.
Organic sulfonium compoundsCHEMONTID:0000508Organic compounds containing the sulfonium cation, with the general formula [SR3]+ (R=any atom).
Organic sulfuric acidsCHEMONTID:0001180Organic compounds containing the sulfuric acid functional group, with the generic structure HOS(=O)(=O)OH.
Organic sulfuric acids and derivativesCHEMONTID:0000403Organic compounds containing the sulfuric acid or a derivative thereof.
Organic sulfuryl bromidesCHEMONTID:0001037Organic compounds containing the sulfuryl bromide functional group.
Organic sulfuryl chloridesCHEMONTID:0001038Organic compounds containing the sulfuryl chloride functional group.
Organic sulfuryl fluoridesCHEMONTID:0001039Organic compounds containing the sulfuryl fluoride functional group.
Organic sulfuryl halidesCHEMONTID:0002869Organic compounds containing the sulfuryl halide group.
Organic sulfuryl iodidesCHEMONTID:0001040Organic compounds containing the sulfuryl iodide functional group.
Organic superoxidesCHEMONTID:0000230Organic compounds containing a superoxide oxyanion.
Organic tetrathionatesCHEMONTID:0002079Organic compounds containing the tetrathionate oxoanion, with the formula [S4O6]2−.
Organic thiocarbonic acid derivativesCHEMONTID:0001672Organic compounds containing the thiocarbonic acid structure or a derivative thereof.
Organic thiocarbonic acidsCHEMONTID:0001193Organic compounds comprising the thiocarbonic acid group, with the general structure HOC(=S)OH.
Organic thionitrous acidsCHEMONTID:0004780Organic compounds containing a thionitrous acid, -HSN=O.
Organic thionylimidesCHEMONTID:0003699Organic compounds that contain the thionylimide group (N=S=O).
Organic thioperoxidesCHEMONTID:0003135Organosulfur compounds with the general formula RSOR' (R,R' = organyl).
Organic thiophosphonic acid derivativesCHEMONTID:0001163Organic compounds containing thiophosphonic acid functional group. Thiophosphonic acid is a phosphorus compound with the formula OP(O)(=S).
Organic thiophosphoric acid amidesCHEMONTID:0001571Organic compounds containing the thiophosphoric acid amide functional group RN(R')OP(O)(O)=S, R,R'=H, alkyl, or aryl group.
Organic thiophosphoric acid halidesCHEMONTID:0001573Organic compounds containing the thiophosphoric acid halide functional group, with the general structure RP(R')(X)=S, where R,R',R'' = O,N and X = halogen group.
Organic thiophosphoric acidsCHEMONTID:0001219Organic compounds containing the thiophosphoric acid group ([H]OP(=S)(O[H])O[H]).
Organic thiophosphoric acids and derivativesCHEMONTID:0001303Organic compounds containing the thiophosphoric acid functional group or a derivative thereof, with the general structure RP(R')(R'')=S, where R,R',R'' = O,N, halogen residue.
Organic thiosulfate saltsCHEMONTID:0004457Organic salts of the thiosulfate ion.
Organic thiosulfatesCHEMONTID:0002080Organic compounds containing the thiosulfate oxoanion, with the formula [S2O3]2-, or its conjugate base.
Organic thiosulfinic acidsCHEMONTID:0004703Organic compounds containing a thiosulfinyl group (HS(S)OH). They have the general structure RS(=S)OH, where R = H or organyl.
Organic thiosulfuric acids and derivativesCHEMONTID:0002035Organic compounds containing the thiosulfuric acid functional group or a derivative thereof.
Organic tin saltsCHEMONTID:0004038Organic salt compounds containing a tin atom in its ionic form.
Organic transition metal saltsCHEMONTID:0003997Organic salt compounds containing a transition metal atom in its ionic form.
Organic triazanesCHEMONTID:0003992Organic compounds containing the triazane group (NH2NHNH2) or a hydrocarbyl derivative thereof.
Organic triazenesCHEMONTID:0001898Organic compounds containing the triazene group (-N-N=N), which consists of an amine directly bonding to an azo group.
Organic trisulfidesCHEMONTID:0002799Organosulfur compounds with the general formula RSSSR' (R,R'=alkyl, aryl).
Organic zwitterionsCHEMONTID:0003610Organic neutral compounds having formal unit electrical charges of opposite sign.
Organo-alkali-metal compoundsCHEMONTID:0001372Organic compounds containing an alkali metal atom.
Organo-post-transition metal compoundsCHEMONTID:0001523Organic compounds containing a post-transition metal atom.
Organoalkaline-earth metal compoundsCHEMONTID:0000277Organic compounds containing an alkaline earth metal atom.
Organoaluminium compoundsCHEMONTID:0001529Compounds containing bond between a carbon atom and an aluminum atom.
Organoantimony compoundsCHEMONTID:0000349Compounds containing a bond between a carbon atom and an antimony atom.
Organoarsenic compoundsCHEMONTID:0000405Compounds containing bond between a carbon atom and an arsenic atom.
Organoarsenic sulfidesCHEMONTID:0004241Organoarsenic compounds with the general formula R[As]S, where R = organyl group.
Organoarsinous acid estersCHEMONTID:0004247Organoarsonous acid derivatives, where the hydrogen atom of the hydroxyl group is replaced by an organyl group.
Organoarsinous acidsCHEMONTID:0004248As-hydrocarbyl compounds with the general formula R2As(OH), where R is an organic group.
Organoarsonous acidsCHEMONTID:0003337As-hydrocarbyl compounds with the general formula RAs(OH)2, where R is an organic group.
OrganoastatidesCHEMONTID:0001514Compounds containing a chemical bond between a carbon atom and an astatin atom.
OrganoazidesCHEMONTID:0004467Compounds bearing the group N3, viz. -N=N+=N- attached to an organic group.
Organoboron compoundsCHEMONTID:0002795Organic compounds containing a carbon-boron bond.
OrganoboroxinesCHEMONTID:0003222Organic compounds containing a boroxine ring B-substituted with an organyl group.
OrganobromidesCHEMONTID:0001515Compounds containing a chemical bond between a carbon atom and a bromine atom.
OrganochloridesCHEMONTID:0001516Compounds containing a chemical bond between a carbon atom and a chlorine atom.
OrganochlorosilanesCHEMONTID:0004444Organosilicon compounds where the tetravalent silicon atom is linked to one or more chlorine atoms.
Organochromium compoundsCHEMONTID:0004073Compounds containing a bond between a carbon atom and a chromium atom.
Organocopper compoundsCHEMONTID:0004017Compounds containing a bond between a carbon atom and a copper atom.
OrganofluoridesCHEMONTID:0001517Compounds containing a chemical bond between a carbon atom and a fluorine atom.
Organogold compoundsCHEMONTID:0000473Organic compounds containing a bond between a carbon atom and a gold atom.
Organohalogen compoundsCHEMONTID:0000267Organic compounds containing a bond between a carbon atom and a halogen atom (At, F, Cl, Br, I).
Organoheterocyclic compoundsCHEMONTID:0000002Compounds containing a ring with least one carbon atom and one non-carbon atom.
OrganoheterosilanesCHEMONTID:0004445Organosilicon compounds where the tetravalent silicon atom is linked to one or more heteroatoms.
OrganoiodidesCHEMONTID:0001518Compounds containing a chemical bond between a carbon atom and an iodine atom.
Organolead compoundsCHEMONTID:0004024Compounds containing bond between a carbon atom and a lead atom.
Organolead sulfidesCHEMONTID:0004288Organolead compounds containing a divalent selenium atom linked to two lead atoms, each linked to at least one organyl group.
Organolithium compoundsCHEMONTID:0000406Organic compounds containing a bond between a carbon atom and lithium atom.
Organomagnesium compoundsCHEMONTID:0000287Organic compounds containing a bond between a carbon atom and magnesium atom.
Organomagnesium halidesCHEMONTID:0004594Organomagnesium compounds with the formula RMgX, where R=organyl group, and X = halogen atom.
Organomercurial compoundsCHEMONTID:0000407Organic compounds containing a bond between a carbon atom and mercury atom.
Organometallic compoundsCHEMONTID:0000462Organic compounds containing a bond between a carbon atom and metal atom.
Organometallic peroxidesCHEMONTID:0004614Organic compounds that contain a peroxide group substituted with a an organometallic group.
Organometalloid compoundsCHEMONTID:0001370Organic compounds containing a metalloid atom.
Organonickel compoundsCHEMONTID:0004492Organic compounds containing a bond between a carbon atom and a nickel atom.
Organonitrogen compoundsCHEMONTID:0000278Organic compounds containing a nitrogen atom.
Organooxygen compoundsCHEMONTID:0000323Organic compounds containing a bond between a carbon atom and an oxygen atom.
Organophosphine oxidesCHEMONTID:0001309Organic compounds containing the phosphine oxide group, with the general formula R3P=O or R3P+O-.
Organophosphinic acids and derivativesCHEMONTID:0003014P-hydrocarbyl derivatives of phosphinic acid.
Organophosphorotrithioic acids and derivativesCHEMONTID:0001570Organic compounds containing the organophosphorotrithioic acid structure or a derivative thereof. They have the general structure ROP(=S)(SR')SR\", where R-R\"= any atom.
Organophosphorus compoundsCHEMONTID:0000400Organic compounds containing the phosphorus atom.
Organopnictogen compoundsCHEMONTID:0004557Compounds containing a bond between carbon a pnictogen atom. Pnictogens are p-block element atoms that are in the group 15 of the periodic table.
Organoselenium compoundsCHEMONTID:0002468Organic compounds containing a carbon-selenium bond.
Organosilicon compoundsCHEMONTID:0003194Organic compounds containing a C[Si] bond.
Organosilver compoundsCHEMONTID:0004025Organic compounds containing a bond between a carbon atom and a silver atom.
Organosulfenic acid amidesCHEMONTID:0001172Compounds derived from a sulfenic acid, RSOH (R= organyl, not H), by replacement of -OH by -NR2.
Organosulfenic acid halidesCHEMONTID:0001174Compounds derived from a sulfenic acid, RSOH (R = organyl, not H), where the hydroxyl group is replace by a halogen atom.
Organosulfenic acidsCHEMONTID:0001235Compounds containing a sulfenic acid functional group, with the general structure RSOH (R not H).
Organosulfenic acids and derivativesCHEMONTID:0000268Compounds derived from sulfenic acid, with the general formula R1SR2 ( R1= organyl, R2=any heteroatom).
OrganosulfonamidesCHEMONTID:0001585Compounds containing the sulfonamide functional group, an amide of sulfonic acid with the general structure R1S(=O)2N(R2)R3 (R1=alkyl, aryl; R2,R3=H, alkyl, aryl).
Organosulfonic acid estersCHEMONTID:0001178Esters of sulfonic acid, which have the general structure RS(=O)2OR' (R,R' = organyl, not H).
Organosulfonic acidsCHEMONTID:0001179Compounds containing the sulfonic acid group, which has the general structure RS(=O)2OH (R is not a hydrogen atom).
Organosulfonic acids and derivativesCHEMONTID:0000270Compounds containing a sulfonic acid or derivative, with the general structure RS(=O)2X (R=alkyl, aryl; X=any heteroatom).
Organosulfonic anhydridesCHEMONTID:0003990Organic compounds having the structure RS(=O)2OS(=O)2R', where R = organyl group and R' = H or organyl group.
Organosulfur compoundsCHEMONTID:0000004Organic compounds containing a carbon-sulfur bond.
Organotellurium compoundsCHEMONTID:0002469Compounds containing bond between a carbon atom and a tellurium atom.
OrganotetrahaloarsoranesCHEMONTID:0004243Organoarsenic compounds, having a pentavalent arsenic atom linked to four halogen atoms and a organic group.
Organothalium compoundsCHEMONTID:0004539Compounds containing a bond between a carbon atom and a thalium atom.
Organothiophosphorus compoundsCHEMONTID:0001438Organic derivatives of thiophosphonic acid, thiophosphoric acid, dithiophosphoric acid, or phosphorotrithioic acid, or derivatives thereof. Thiophosphonic acid, dithiophosphoric acid, thiophosphoric acid, and phosphorotrithioic acid are thiophosphorus compounds with the formula OP(O)(=S), OP(S)(=S)O, OP(O)(=S)O, and OP(=S)(S)S, respectively.
Organotin compoundsCHEMONTID:0001524Compounds containing bond between a carbon atom and a tin atom.
Organotin selenidesCHEMONTID:0004285Organotin compounds containing a divalent selenium atom linked to two tin atoms, each linked to at least one organyl group.
Organotin sulfidesCHEMONTID:0004286Organotin compounds containing a divalent sulfur atom linked to two tin atoms, each linked to at least one organyl group.
Organotin telluridesCHEMONTID:0004287Organotin compounds containing a divalent tellurium atom linked to two tin atoms, each linked to at least one organyl group.
Organotransition metal compoundsCHEMONTID:0001371Organic compounds containing a transition metal atom.
Organozinc compoundsCHEMONTID:0004592Organometallic compounds that contain a chemical bond between a carbon atom and a zinc atom.
Ormosia-type alkaloidsCHEMONTID:0002825Aloperine alkaloids with a structure based on the ormosanine skeleton.
Ortho acidsCHEMONTID:0002928Ortho acid derivatives of carboxylic acids, with the general formula RC(OH)3.
Ortho amidesCHEMONTID:0002927Hypothetical Compounds having the general structure RC(NH2)3, and N-substituted derivatives thereof.
Ortho cresolsCHEMONTID:0001274Organic compounds containing an ortho-cresol moiety, which consists of a benzene bearing one hydroxyl group at ring positions 1 and 2, respectively.
Ortho dioxinsCHEMONTID:0001385Compounds containing a dioxin ring, in which the two oxygen atoms are at positions 1 and 2 respectively.
Ortho estersCHEMONTID:0002926Compounds having the general structure RC(OR')3 ( R' not H), or the structure C(OR')4 ( R' not H).
Ortho thiazepinesCHEMONTID:0001353Compounds containing a thiazepine ring, in which the sulfur and nitrogen atoms are at positions 1 and 2 respectively.
Orthocarboxylic acid derivativesCHEMONTID:0001236Organic compounds containing the orhtocarboxylic acid functional group, with the RC(X)(X)X (R=H, alkyl, aryl; X=OH, alkoxy, aryloxy, substituted amino, etc.).
OS-thioperoxolsCHEMONTID:0003157Thioperoxols with the general formula R-OSH (R = organyl group).
Other glycerolipidsCHEMONTID:0001512Glycerolipids that do not belong to either the class Alk(en)yl Diacylglycerols, Diacylglycerols, Glycosylglycerols, Monoacylglycerols, Other Glycerolipids or Triacylglycerols.
Other glycerophosphoinositol phosphatesCHEMONTID:0001718Glycerophosphoinositol phosphates not belonging to Lysophosphatidylinositol Phosphates, or the Phosphatidylinositol Phosphates.
Other hydroperoxyeicosapolyenoic acidsCHEMONTID:0001525Hydroperoxyeicosapolyenoic acids which do not belong to the hydroperoxyeicosapentaenoic acids, the hydroperoxyeicosatetraenoic acids, or the hydroperoxyeicosatrienoic acids.
Other hydroxyeicosapolyenoic acidsCHEMONTID:0001422Hydroxyeicosapolyenoic acids which do not belong to the Hydroxyeicosapentaenoic acids, the Hydroxyeicosatetraenoic acids, or the Hydroxyeicosatrienoic acids.
Other mixed metal/non-metal oxoanionic compoundsCHEMONTID:0001442Inorganic compounds containing a non-metal atom linked to a metallic oxoanionic moiety.
Other non-metal halidesCHEMONTID:0000437Inorganic compounds containing 'other non-metals' and halogen.
Other non-metal hydridesCHEMONTID:0000552Inorganic compounds in which the heaviest atom bonded to a hydrogen atom is belongs to the class of 'other non-metals'.
Other non-metal nitridesCHEMONTID:0000553Inorganic compounds of nitrogen where nitrogen has a formal oxidation state of −3, and the heaviest atom bonded to it belongs to the class of 'other non-metals'.
Other non-metal organidesCHEMONTID:0000453Inorganic compounds belonging to either of the other non-metal Hydrides, other non-metal nitrides, other non-metal oxides, or the other non-metal sulfides.
Other non-metal oxidesCHEMONTID:0000554Inorganic compounds containing an oxygen atom of an oxidation state of -2, in which the heaviest atom bonded to the oxygen belongs to the class of 'other non-metals'.
Other non-metal sulfidesCHEMONTID:0000555Inorganic compounds containing a sulfur atom of an oxidation state of -2, in which the heaviest atom bonded to the oxygen belongs to the class of other non-metals.
Oxaborine derivativesCHEMONTID:0001717Compounds containing a six-member aliphatic heterocycle made up of one oxygen atom, a boron atom, and three carbon atoms.
Oxaborole derivativesCHEMONTID:0002227Compounds containing a five-member aliphatic heterocycle made up of one oxygen atom, a boron atom, and three carbon atoms.
OxacephemsCHEMONTID:0000171Organic compounds containing the oxacepehem skeleton, which is similar to a cephem, but with oxygen substituted for the sulfur.
Oxacyclic compoundsCHEMONTID:0004140Organic compounds containing an heterocycle with at least one oxygen atom linked to a ring carbon.
OxadiazinesCHEMONTID:0004736Heterocyclic compounds containing an oxadiazine ring, which is an unsaturated six-membered heterocycle that consists of one oxygen 2 nitrogen, and 3 carbon atoms.
OxadiazolesCHEMONTID:0001822Organic compounds containing an oxadiazole ring, which is a five-member aromatic heterocycle with two nitrogen atoms, an oxygen atom, and a carbon atom.
OxadiazolidinesCHEMONTID:0001933Organic compounds containing an oxadiazole ring, which is a five-member saturated aliphatic heterocycle with two nitrogen atoms, an oxygen atom, and two carbon atoms.
OxaergolinesCHEMONTID:0002681Alkaloids with a structure based on the oxaergoline skeleton, an analog of ergoline obtained by substituted one of the pyridine C atom by an oxygen atom.
OxamorphinansCHEMONTID:0001785Polycyclic compounds with a four-ring skeleton with three condensed six-member rings forming a partially hydrogenated naphthopyran moiety, one of which is aromatic while the two others are alicyclic.
OxanesCHEMONTID:0002012Compounds containing an oxane (tetrahydropyran) ring, which is a six-member saturated aliphatic heterocycle with one oxygen atom and five carbon atoms.
OxaphospholanesCHEMONTID:0000782Compounds containing an oxaphospholane moiety, which consists of a saturated aliphatic five-member ring with two oxygen atoms, a phosphorus atom, and two carbon atoms. Isomers of oxaphospholane include 1,2-oxaphosphane, and 1,3-oxaphospholane.
Oxasteroids and derivativesCHEMONTID:0002382Steroid derivatives where a carbon atom of the steroid is replaced by an oxygen atom.
OxathianesCHEMONTID:0001889Compounds containing an oxathiane moiety, which consists of a saturated aliphatic six-member ring with one oxygen atom, a sulfur atom, and four carbon atoms. Isomers of oxaphospholane include 1,2-oxathiane, 1,3-oxathiane,and 1,4-oxathiane.
OxathiaphospholanesCHEMONTID:0002649Heterocyclic compounds containing an oxathiophospholane ring, which is a saturated, five-membered ring with one oxygen atom, one sulfur atom, one phosphorus atom and two carbon atoms.
OxathiazolidinesCHEMONTID:0002578Heterocyclic compounds containing an oxathiazolidine, a saturated five-membered ring having two carbon atoms, one oxygen atom, one nitrogen atom, and one sulfur atom.
OxathietanesCHEMONTID:0001886Compounds containing an oxathietane moiety, which consists of a saturated aliphatic four-member ring with one oxygen atom, a sulfur atom, and two carbon atoms. Isomers of oxaphospholane include 1,2-oxathietane, and 1,3-oxathietane.
OxathiinsCHEMONTID:0002058Compounds containing an oxathiin moiety, which consists of an unsaturated aliphatic six-member ring with one oxygen atom, a sulfur atom, and four carbon atoms. Isomers of oxaphospholane include 1,2-oxathiin, 1,3-oxathiin,and 1,4-oxathiin.
OxathiolanesCHEMONTID:0000106Compounds containing an oxathiolane moiety, which consists of a saturated aliphatic five-member ring with one oxygen atom, a sulfur atom, and three carbon atoms. Isomers of oxaphospholane include meta-oxathiolane, and ortho-oxathiolane.
OxathiolesCHEMONTID:0002261Organic heterocyclic compounds containing a saturated five-membered ring with three carbon atoms, one oxygen atom, one sulfur atom, and one double bond.
OxatriazolesCHEMONTID:0001931Compounds containing an oxatriazole moiety, which consists of an unsaturated aliphatic five-member ring with one oxygen atom, three nitrogen, one carbon atom, and two double bonds. Isomers of oxatriazole include 1,2,3,4-oxatriazole, and 1,2,3,5-oxatriazole.
OxatriazolidinesCHEMONTID:0001932Organic compounds containing an oxatriazolidine ring, which is a five-member saturated aliphatic heterocycle with three nitrogen atoms, an oxygen atom, and a carbon atom.
OxazaphosphinanesCHEMONTID:0002466Organic heterocyclic compounds containing an oxazaphosphinane ring, which consists of three carbon atoms, one nitrogen atom, and one phosphorus atom.
OxazepinesCHEMONTID:0000066Compounds containing an oxazepine moiety, which consists of an unsaturated aliphatic seven-member ring with one oxygen atom, a nitrogen atom, and five carbon atoms. Isomers of oxazepine include 1,2-oxazepine, 1,3-oxazepine,and 1,4-oxazepine.
OxazinanesCHEMONTID:0000107Compounds containing an oxazinane moiety, which consists of a saturated aliphatic six-member ring with one oxygen atom, a nitrogen atom, and four carbon atoms. Isomers of oxaphospholane include 1,2-oxazinane, 1,3-oxazinane, and 1,4-oxazinane.
OxazinesCHEMONTID:0000082Compounds containing an oxazine moiety, which consists of an unsaturated aliphatic six-member ring with one oxygen atom, a nitrogen atom, four carbon atoms, and two double bonds. Isomers of oxaphospholane include 1,2-oxazine, 1,3-oxazine, and 1,4-oxazine.
OxaziridinesCHEMONTID:0003092Organic heterocyclic compounds containing oxaziridine, a three-membered ring containing an oxygen atom, a carbon atom, and a nitrogen atom.
OxazolesCHEMONTID:0000083Compounds containing an oxazole ring, which is a five-membered aromatic heterocycle with one oxygen, one nitrogen, and three carbon atoms. Isomers include 1,2-oxazole and 1,3-oxazole.
OxazolidinedionesCHEMONTID:0000197Compounds containing an oxazolidine ring which bears two ketones.
OxazolidinesCHEMONTID:0000108Compounds containing an oxazolidine moiety, which consists of a saturated aliphatic five-member ring with one oxygen atom, one nitrogen, three carbon atoms, and two double bonds.
OxazolidinonesCHEMONTID:0000196Compounds containing an oxazolidinone moiety, which is an oxazolidine bearing a ketone group.
OxazolinesCHEMONTID:0000084Organic compounds containing 1,3-oxazoline, a five-membered ring with a nitrogen and an oxygen atoms at the 1- and 3-position, respectively. Additionally, it contains two double bonds.
OxazolopyrazinesCHEMONTID:0002197Polycyclic compounds containing an oxazole ring fused to a pyrazine ring.
OxazolopyridinesCHEMONTID:0002118Polycyclic compounds containing an oxazole ring fused to a pyridine ring.
OxepanesCHEMONTID:0001729Compounds containing an oxepane ring, which is a seven-member saturated aliphatic heterocycle with one oxygen and six carbon atoms.
Oxetane amino acids and derivativesCHEMONTID:0001695Sugar amino acids containing an oxetane ring between the carboxy- and the amino terminals of the amino acid chain.
OxetanesCHEMONTID:0000070Compounds containing an oxetane ring, which is a four-member saturated aliphatic ring with an oxygen, and three carbon atoms.
OxetenesCHEMONTID:0000073Compounds containing an oxetene ring, which is a four-member unsaturated aliphatic ring with an oxygen, three carbon atoms, and one CC double bond.
Oxime carbamatesCHEMONTID:0004752Oxime ether derivatives with the general formula CC(R)=NOC(=O)N(R')R\", where R-R\" = H or organyl.
Oxime estersCHEMONTID:0003879Organic compounds containing an ester derivative of the oxime functional group.
Oxime ethersCHEMONTID:0001010Compounds containing the oxime ether functional group, with the general structure R1(R2)C=NOR3 ( R3 not H).
Oxime organothiophosphatesCHEMONTID:0004765Organic compounds containing an oxime group, which is O-substituted with a thiophosphoric acid ester.
OximesCHEMONTID:0000411Compounds containing the oxime functional group, with the general structure R1(R2)C=NOH.
Oxirane carboxylic acidsCHEMONTID:0002409Compounds containing an oxirane ring bearing a carboxylic acid group.
Oxirane carboxylic acids and derivativesCHEMONTID:0001864Compounds containing an oxirane ring bearing a carboxylic acid group (or a derivative thereof).
OxirenesCHEMONTID:0004170Organic compounds containing oxirene, an unsaturated three-membered ring with two carbon atoms and one oxygen atom.
OxocinsCHEMONTID:0001796Compounds containing an oxocin ring, which is a eight-member unsaturated aromatic ring containing one oxygen atom and seven carbon atoms.
Oxoeicosapolyenoic acidsCHEMONTID:0000393Eicosapolyenoic acids (C20 fatty acid with more than one C=C double bonds on the chain).
OxoisoaporphinesCHEMONTID:0004118Alkaloids with a structure that contains the isoaporphine skeleton with an oxo group at the 7-position.
OxolanesCHEMONTID:0001967Organic compounds containing an oxolane (tetrahydrofuran) ring, which is a saturated aliphatic five-member ring containing one oxygen and five carbon atoms.
Oxonium ylidesCHEMONTID:0003701Compounds having the general structure R2[O+]-C-R2. Oxonium ylides also constituted a class of 1,3-dipolar compounds of general structure R2C=[O+]-Y- , comprising carbonyl imides, carbonyl oxides and carbonyl ylides.
OxoprolinesCHEMONTID:0002089Compounds containing an oxoproline moiety, which consists of a pyrrolidine ring bearing a carboxylic acid group at the ring position 2, and a ketone group.
OxosteroidsCHEMONTID:0001194Steroid derivatives carrying a C=O group attached to steroid skeleton.
Oxygen-containing organoarsenic compoundsCHEMONTID:0004280Organoarsenic compounds that containing an oxygen atom.